Products 4042-30-2
CAS 4042-30-2 appears in our catalog under these names: 2-Hydroxy-3-cyclohexyl-1,4-naphthoquinone, Parvaquone, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 25g, 50g, 250g, 100g, 1g, 5g.
3-cyclohexyl-4-hydroxynaphthalene-1,2-dione (CAS 4042-30-2) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 3-cyclohexyl-4-hydroxynaphthalene-1,2-dione. InChIKey: XBGHCDVBZZNDBY-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 3-cyclohexyl-4-hydroxynaphthalene-1,2-dione |
| InChIKey | XBGHCDVBZZNDBY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C3=CC=CC=C3C(=O)C2=O)O |
Computed by PubChem (NCBI)
Synonyms:
Parvaquone, 2-Cyclohexyl-3-hydroxy-1,4-naphthoquinone, 3-cyclohexyl-4-hydroxynaphthalene-1,2-dione, 2-hydroxy-3-cyclohexyl-1,4-naphthoquinone, 2-cyclohexyl-3-hydroxynaphthalene-1,4-dione, 1,4-Naphthalenedione, 2-cyclohexyl-3-hydroxy-, 2-Cyclohexyl-3-hydroxynaphthoquinone, Parvaquonum [Latin], Parvaquona [Spanish], Parvaquona