Products 40421-03-2

CAS 40421-03-2 is the registry number for Carbamazepine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride (CAS 40421-03-2) is a chemical compound with the molecular formula C15H10Br2ClNO and a molecular weight of 415.50 g/mol. IUPAC name: 5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride. InChIKey: VZIGUCCPGWDDML-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10Br2ClNO
Molecular weight415.50 g/mol
IUPAC name5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride
InChIKeyVZIGUCCPGWDDML-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C(C3=CC=CC=C3N2C(=O)Cl)Br)Br

Computed by PubChem (NCBI)