CAS 40421-03-2 is the registry number for Carbamazepine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride (CAS 40421-03-2) is a chemical compound with the molecular formula C15H10Br2ClNO and a molecular weight of 415.50 g/mol. IUPAC name: 5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride. InChIKey: VZIGUCCPGWDDML-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2ClNO |
|---|---|
| Molecular weight | 415.50 g/mol |
| IUPAC name | 5,6-dibromo-5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl chloride |
| InChIKey | VZIGUCCPGWDDML-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(C3=CC=CC=C3N2C(=O)Cl)Br)Br |
Computed by PubChem (NCBI)