CAS 40429-04-7 is the registry number for 2,2-Dimethyl-2,3-dihydro-1H-carbazol-4(9H)-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
2,2-dimethyl-3,9-dihydro-1H-carbazol-4-one (CAS 40429-04-7) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 2,2-dimethyl-3,9-dihydro-1H-carbazol-4-one. InChIKey: CWRWHDVCYDYQAV-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 2,2-dimethyl-3,9-dihydro-1H-carbazol-4-one |
| InChIKey | CWRWHDVCYDYQAV-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)