CAS 404366-59-2 appears in our catalog under these names: 5-Bromo-6-chloro-3-indolyl phosphate dis, odium monohydrate, 2 g, 5-Bromo-6-chloro-3-indolyl phosphate disodium salt, 95%, 5-Bromo-6-chloro-3-indoxyl phosphate, disodium salt monohydrate, 95%, 5-Bromo-6-chloro-3-indoxyl phosphate, disodium salt monohydrate, Sodium 5-bromo-6-chloro-1H-indol-3-yl phosphate, 95%, 95%. Offered by: Roth, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 2g, 1g, 5g, 25g, 10g, 50g, 250mg, 100mg.
Disodium;(5-bromo-6-chloro-1H-indol-3-yl) phosphate (CAS 404366-59-2) is a chemical compound with the molecular formula C8H4BrClNNa2O4P and a molecular weight of 370.43 g/mol. IUPAC name: disodium;(5-bromo-6-chloro-1H-indol-3-yl) phosphate. InChIKey: YSYZSUYFGCLJJB-UHFFFAOYSA-L.
| Molecular formula | C8H4BrClNNa2O4P |
|---|---|
| Molecular weight | 370.43 g/mol |
| IUPAC name | disodium;(5-bromo-6-chloro-1H-indol-3-yl) phosphate |
| InChIKey | YSYZSUYFGCLJJB-UHFFFAOYSA-L |
| SMILES | C1=C2C(=CC(=C1Br)Cl)NC=C2OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)