CAS 404366-61-6 is the registry number for 4-Chloro-2-{2-((4-chlorophenyl)sulfanyl)acetamido}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]benzoic acid (CAS 404366-61-6) is a chemical compound with the molecular formula C15H11Cl2NO3S and a molecular weight of 356.2 g/mol. IUPAC name: 4-chloro-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]benzoic acid. InChIKey: TWRJYLRVPKTDEK-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO3S |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 4-chloro-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]benzoic acid |
| InChIKey | TWRJYLRVPKTDEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SCC(=O)NC2=C(C=CC(=C2)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)