CAS 40447-58-3 appears in our catalog under these names: Isopropyldiphenylsulfonium tetrafluoroborate, 95+%, Isopropyldiphenylsulfonium Tetrafluoroborate, >95%, >95%, ISOPROPYLDIPHENYLSULFONIUM TETRAFLUOROBORATE, >95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
Diphenyl(propan-2-yl)sulfanium tetrafluoroborate (CAS 40447-58-3) is a chemical compound with the molecular formula C15H17BF4S and a molecular weight of 316.2 g/mol. IUPAC name: diphenyl(propan-2-yl)sulfanium tetrafluoroborate. InChIKey: OYVGOJMOYZVZFZ-UHFFFAOYSA-N.
| Molecular formula | C15H17BF4S |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | diphenyl(propan-2-yl)sulfanium tetrafluoroborate |
| InChIKey | OYVGOJMOYZVZFZ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC(C)[S+](C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)