Products 405-18-5
CAS 405-18-5 appears in our catalog under these names: 2-Phenylethene-1-sulfonyl fluoride, 95%, 2-PHENYLETHENESULFONYL FLUORIDE, 2-Phenylethene-1-sulfonyl fluoride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
(E)-2-phenylethenesulfonyl fluoride (CAS 405-18-5) is a chemical compound with the molecular formula C8H7FO2S and a molecular weight of 186.21 g/mol. IUPAC name: (E)-2-phenylethenesulfonyl fluoride. InChIKey: VDCNEIUADPFQPG-VOTSOKGWSA-N.
| Molecular formula | C8H7FO2S |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | (E)-2-phenylethenesulfonyl fluoride |
| InChIKey | VDCNEIUADPFQPG-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)F |
Computed by PubChem (NCBI)
Synonyms:
Ethenesulfonyl fluoride, 2-phenyl-, (1E)-2-phenylethene-1-sulfonyl fluoride, (E)-2-phenylethene-1-sulfonyl fluoride, 2-phenylethene-1-sulfonyl fluoride, (E)-2-phenylethenesulfonyl fluoride, 2-phenylethenesulfonyl fluoride, 2-Phenylethenesulfonyl fluoride, 95%, (E)-2-phenylethene-1-sulfonylfluoride