CAS 40503-93-3 appears in our catalog under these names: 4-(3-(Trifluoromethyl)phenyl)cyclohexan-1-one, 4-(3-(Trifluoromethyl)phenyl)cyclohexan-1-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-[3-(trifluoromethyl)phenyl]cyclohexan-1-one (CAS 40503-93-3) is a chemical compound with the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]cyclohexan-1-one. InChIKey: XAOCHZUKYOVYOQ-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O |
|---|---|
| Molecular weight | 242.24 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]cyclohexan-1-one |
| InChIKey | XAOCHZUKYOVYOQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)