CAS 405230-80-0 appears in our catalog under these names: 2–chloro–5–fluoro–4–nitropyridine 1–oxide, 2-Chloro-5-fluoro-4-nitropyridine 1-oxide 95%, 2-chloro-5-fluoro-4-nitropyridine 1-oxide, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
2-chloro-5-fluoro-4-nitro-1-oxidopyridin-1-ium (CAS 405230-80-0) is a chemical compound with the molecular formula C5H2ClFN2O3 and a molecular weight of 192.53 g/mol. IUPAC name: 2-chloro-5-fluoro-4-nitro-1-oxidopyridin-1-ium. InChIKey: MEGKAPYCJRCDAE-UHFFFAOYSA-N.
| Molecular formula | C5H2ClFN2O3 |
|---|---|
| Molecular weight | 192.53 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | MEGKAPYCJRCDAE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C[N+](=C1Cl)[O-])F)[N+](=O)[O-] |
Computed by PubChem (NCBI)