Products 40526-96-3
CAS 40526-96-3 is the registry number for A20832. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 2-acetyl-5,5-dichloro-4-methylpent-4-enoate (CAS 40526-96-3) is a chemical compound with the molecular formula C10H14Cl2O3 and a molecular weight of 253.12 g/mol. IUPAC name: ethyl 2-acetyl-5,5-dichloro-4-methylpent-4-enoate. InChIKey: CSIXHPCPUJVRQT-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2O3 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | ethyl 2-acetyl-5,5-dichloro-4-methylpent-4-enoate |
| InChIKey | CSIXHPCPUJVRQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(=C(Cl)Cl)C)C(=O)C |
Computed by PubChem (NCBI)