CAS 4053-50-3 appears in our catalog under these names: 6-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline, >95% (HPLC), 6-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline 97%. Offered by: TRC, Ambeed. Available pack sizes: 250mg, 500mg, 50mg, 100mg, 1g.
6-methoxy-2,2,4-trimethyl-1H-quinoline (CAS 4053-50-3) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 6-methoxy-2,2,4-trimethyl-1H-quinoline. InChIKey: KQICGCZZOQMMAX-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 6-methoxy-2,2,4-trimethyl-1H-quinoline |
| InChIKey | KQICGCZZOQMMAX-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)OC)(C)C |
Computed by PubChem (NCBI)