CAS 405520-49-2 is the registry number for 4-Amino-4′-trifluoromethylbiphenyl-3-carbonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-amino-5-[4-(trifluoromethyl)phenyl]benzonitrile (CAS 405520-49-2) is a chemical compound with the molecular formula C14H9F3N2 and a molecular weight of 262.23 g/mol. IUPAC name: 2-amino-5-[4-(trifluoromethyl)phenyl]benzonitrile. InChIKey: LTTZFWAFKOEYAW-UHFFFAOYSA-N.
| Molecular formula | C14H9F3N2 |
|---|---|
| Molecular weight | 262.23 g/mol |
| IUPAC name | 2-amino-5-[4-(trifluoromethyl)phenyl]benzonitrile |
| InChIKey | LTTZFWAFKOEYAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)N)C#N)C(F)(F)F |
Computed by PubChem (NCBI)