CAS 40567-80-4 appears in our catalog under these names: TOPS, 95%, TOPS/ 99.71% (existing batch purity), TOPS, N-ETHYL-N-SULFOPROPYL-M-TOLUIDINE, TOPS, 97%, 97%. Offered by: AmBeed, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 500mg, 10mM (in 1ml dmso), 10g, 25g, 100g, 1 g.
Sodium 3-(N-ethyl-3-methylanilino)propane-1-sulfonate (CAS 40567-80-4) is a chemical compound with the molecular formula C12H18NNaO3S and a molecular weight of 279.33 g/mol. IUPAC name: sodium 3-(N-ethyl-3-methylanilino)propane-1-sulfonate. InChIKey: NJZLCEFCAHNYIR-UHFFFAOYSA-M.
| Molecular formula | C12H18NNaO3S |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | sodium 3-(N-ethyl-3-methylanilino)propane-1-sulfonate |
| InChIKey | NJZLCEFCAHNYIR-UHFFFAOYSA-M |
| SMILES | CCN(CCCS(=O)(=O)[O-])C1=CC=CC(=C1)C.[Na+] |
Computed by PubChem (NCBI)