CAS 4058-30-4 is the registry number for Disperse Orange 44. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-cyanoethyl)anilino]propanenitrile (CAS 4058-30-4) is a chemical compound with the molecular formula C18H15ClN6O2 and a molecular weight of 382.8 g/mol. IUPAC name: 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-cyanoethyl)anilino]propanenitrile. InChIKey: ZXXVVTBKBDDTSE-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN6O2 |
|---|---|
| Molecular weight | 382.8 g/mol |
| IUPAC name | 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-cyanoethyl)anilino]propanenitrile |
| InChIKey | ZXXVVTBKBDDTSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl)N(CCC#N)CCC#N |
Computed by PubChem (NCBI)