Products 40584-11-0

CAS 40584-11-0 is the registry number for 2-Bromo-N-(4-chlorophenethyl)ethan-1-amine hydrobromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

N-(2-bromoethyl)-2-(4-chlorophenyl)ethanamine;hydrobromide (CAS 40584-11-0) is a chemical compound with the molecular formula C10H14Br2ClN and a molecular weight of 343.48 g/mol. IUPAC name: N-(2-bromoethyl)-2-(4-chlorophenyl)ethanamine;hydrobromide. InChIKey: WTUBOZFKMZNBEM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14Br2ClN
Molecular weight343.48 g/mol
IUPAC nameN-(2-bromoethyl)-2-(4-chlorophenyl)ethanamine;hydrobromide
InChIKeyWTUBOZFKMZNBEM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCNCCBr)Cl.Br

Computed by PubChem (NCBI)