CAS 40618-96-0 appears in our catalog under these names: 3-Phenyl-3-(trifluoromethyl)diaziridine, 95%, 3-Phenyl-3-(trifluoromethyl)-diaziridine. Offered by: Chemat Brand, TRC, Fluorochem. Available pack sizes: on request, 500mg, 50mg.
3-phenyl-3-(trifluoromethyl)diaziridine (CAS 40618-96-0) is a chemical compound with the molecular formula C8H7F3N2 and a molecular weight of 188.15 g/mol. IUPAC name: 3-phenyl-3-(trifluoromethyl)diaziridine. InChIKey: IDYOLIBOFIMVHB-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2 |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 3-phenyl-3-(trifluoromethyl)diaziridine |
| InChIKey | IDYOLIBOFIMVHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(NN2)C(F)(F)F |
Computed by PubChem (NCBI)