CAS 406194-70-5 is the registry number for N-(2-Methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)benzamide (CAS 406194-70-5) is a chemical compound with the molecular formula C16H11F3N2OS and a molecular weight of 336.3 g/mol. IUPAC name: N-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)benzamide. InChIKey: UOBPYUFBHWUZPX-UHFFFAOYSA-N.
| Molecular formula | C16H11F3N2OS |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | N-(2-methyl-1,3-benzothiazol-5-yl)-3-(trifluoromethyl)benzamide |
| InChIKey | UOBPYUFBHWUZPX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)NC(=O)C3=CC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)