CAS 406207-65-6 appears in our catalog under these names: 2-tert-Butylimidazo[1,2-a]pyridine, 98%, 2-tert-butylimidazo[1,2-a]pyridine, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-tert-butylimidazo[1,2-a]pyridine (CAS 406207-65-6) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 2-tert-butylimidazo[1,2-a]pyridine. InChIKey: PGLHGXMDGUTQON-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2-tert-butylimidazo[1,2-a]pyridine |
| InChIKey | PGLHGXMDGUTQON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN2C=CC=CC2=N1 |
Computed by PubChem (NCBI)