CAS 406482-73-3 appears in our catalog under these names: 4'-cyano-1,1'-biphenyl-4-ylboronic acid,, 98%, 4'–Cyanobiphenyl–4–ylboronic acid(contains varying amounts of Anhydride), 4–CYANO–BIPHENYLBORIC ACID, (4'-Cyano-[1,1'-biphenyl]-4-yl)boronic acid 98%, (4'-Cyano-[1,1'-biphenyl]-4-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
[4-(4-cyanophenyl)phenyl]boronic acid (CAS 406482-73-3) is a chemical compound with the molecular formula C13H10BNO2 and a molecular weight of 223.04 g/mol. IUPAC name: [4-(4-cyanophenyl)phenyl]boronic acid. InChIKey: JYKQRYHFHIAGJD-UHFFFAOYSA-N.
| Molecular formula | C13H10BNO2 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | [4-(4-cyanophenyl)phenyl]boronic acid |
| InChIKey | JYKQRYHFHIAGJD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C#N)(O)O |
Computed by PubChem (NCBI)