Products 406695-45-2
CAS 406695-45-2 is the registry number for tert-Butyl (1S,4S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S,4S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 406695-45-2) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1S,4S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: HDPGSWMTDGGUEB-JVIMKECRSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1S,4S)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | HDPGSWMTDGGUEB-JVIMKECRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1CC2O |
Computed by PubChem (NCBI)