CAS 40680-45-3 appears in our catalog under these names: Pd(ii) mesoporphyrin ix, 95%, Pd(II) Mesoporphyrin IX, Pd(II) Mesoporphyrin IX, ≥95%, ≥95%, Pd(II) Mesoporphyrin IX. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 25mg, 5mg, Get quote.
3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;palladium(2+) (CAS 40680-45-3) is a chemical compound with the molecular formula C34H36N4O4Pd and a molecular weight of 671.1 g/mol. IUPAC name: 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;palladium(2+). InChIKey: VWVXMTBTLYSQMK-UHFFFAOYSA-L.
| Molecular formula | C34H36N4O4Pd |
|---|---|
| Molecular weight | 671.1 g/mol |
| IUPAC name | 3-[18-(2-carboxyethyl)-8,13-diethyl-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;palladium(2+) |
| InChIKey | VWVXMTBTLYSQMK-UHFFFAOYSA-L |
| SMILES | CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)C)CCC(=O)O)CCC(=O)O)C)C(=C3CC)C)C.[Pd+2] |
Computed by PubChem (NCBI)