Products 40716-68-5
CAS 40716-68-5 is the registry number for (2-cis,6-trans)-Farnesyl Diphosphate. Offered by: TRC. Available pack sizes: 50mg.
2-cis,6-trans-farnesyl diphosphate is a farnesyl diphosphate. It is a conjugate acid of a 2-cis,6-trans-farnesyl diphosphate(3-).
Source: ChEBI
| Molecular formula | C15H28O7P2 |
|---|---|
| Molecular weight | 382.33 g/mol |
| IUPAC name | phosphono [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hydrogen phosphate |
| InChIKey | VWFJDQUYCIWHTN-PVMFERMNSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C\COP(=O)(O)OP(=O)(O)O)/C)/C)C |
Computed by PubChem (NCBI)
Synonyms:
2-cis,6-trans-farnesyl diphosphate, (2Z,6E)-farnesyl diphosphate, (2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate, omega,E,Z-farnesyl diphosphate, (2-cis,6-trans)-Farnesyl Diphosphate, 1fpp, phosphono [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hydrogen phosphate, Diphosphoric acid, mono[(2Z,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl] ester