CAS 40719-58-2 appears in our catalog under these names: H-Lys-Gly-OH bis-Hydrochloride, H–Lys–Gly–OH · HCl, H-Lys-Gly-OH·HCl, H-Lys-Gly-OH·HCl 97%, H-Lys-Gly-OH.HCl, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 500mg, 1g, 5g, 2g, 10g, 100mg, 250mg.
2-[[(2S)-2,6-diaminohexanoyl]amino]acetic acid;hydrochloride (CAS 40719-58-2) is a chemical compound with the molecular formula C8H18ClN3O3 and a molecular weight of 239.70 g/mol. IUPAC name: 2-[[(2S)-2,6-diaminohexanoyl]amino]acetic acid;hydrochloride. InChIKey: DNTASJHHUSNMTJ-RGMNGODLSA-N.
| Molecular formula | C8H18ClN3O3 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-[[(2S)-2,6-diaminohexanoyl]amino]acetic acid;hydrochloride |
| InChIKey | DNTASJHHUSNMTJ-RGMNGODLSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)NCC(=O)O)N.Cl |
Computed by PubChem (NCBI)