Products 40745-44-6
CAS 40745-44-6 appears in our catalog under these names: 1,2-Dihydroacenaphthylen-1-amine 95%, 1,2-Dihydroacenaphthylen-1-amine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1,2-dihydroacenaphthylen-1-amine (CAS 40745-44-6) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-1-amine. InChIKey: LCYNDXQWJAMEAI-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylen-1-amine |
| InChIKey | LCYNDXQWJAMEAI-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC3=C2C1=CC=C3)N |
Computed by PubChem (NCBI)