Products 407587-01-3
CAS 407587-01-3 appears in our catalog under these names: ANO1-IN-1/ 99.66% (existing batch purity), ANO1–IN–1, ANO1-IN-1, 98%, 98%, ANO1-IN-1, 99.57%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg, 10mM/1mL.
6-tert-butyl-2-(2,2-dimethylpropanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (CAS 407587-01-3) is a chemical compound with the molecular formula C18H28N2O2S and a molecular weight of 336.5 g/mol. IUPAC name: 6-tert-butyl-2-(2,2-dimethylpropanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide. InChIKey: QJDASIZKRQHFFS-UHFFFAOYSA-N.
| Molecular formula | C18H28N2O2S |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | 6-tert-butyl-2-(2,2-dimethylpropanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| InChIKey | QJDASIZKRQHFFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)N)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)