CAS 40771-26-4 appears in our catalog under these names: 1,2,3,4-Tetrahydronaphthalene-1,5-diol, 95%, 1,5-Dihydroxytetralin, 1,2,3,4–Tetrahydronaphthalene–1,5–diol, 1,5–Dihydroxy–1,2,3,4–tetrahydronaphthalene, 1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 2,5g, 25G, 100 mg.
1,2,3,4-tetrahydronaphthalene-1,5-diol (CAS 40771-26-4) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 1,2,3,4-tetrahydronaphthalene-1,5-diol. InChIKey: MYIDTCFDQGAVFL-UHFFFAOYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydronaphthalene-1,5-diol |
| InChIKey | MYIDTCFDQGAVFL-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC=C2)O)O |
Computed by PubChem (NCBI)