Products 40796-97-2
CAS 40796-97-2 appears in our catalog under these names: Mdl 72222, 97%, 97%, MDL-72222, MDL 72222, Bemesetron/ 97.37% (existing batch purity), MDL 72222. Offered by: Chemat, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 10mg, 1mg, 5mg.
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3,5-dichlorobenzoate (CAS 40796-97-2) is a chemical compound with the molecular formula C15H17Cl2NO2 and a molecular weight of 314.2 g/mol. IUPAC name: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3,5-dichlorobenzoate. InChIKey: MNJNPLVXBISNSX-PBWFPOADSA-N.
| Molecular formula | C15H17Cl2NO2 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3,5-dichlorobenzoate |
| InChIKey | MNJNPLVXBISNSX-PBWFPOADSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Bemesetron (USAN/INN), BEMESETRON, 3-Tropanyl-3,5-dichlorobenzoate, Bemesetron (MDL 72222), [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3,5-dichlorobenzoate, 1alphaH,5alphaH-Tropan-3alpha-yl 3,5-dichlorobenzoate, Bemesetronum, Benzoic acid, 3,5-dichloro-, 8-methyl-8-azabicyclo(3.2.1)oct-3-yl ester, endo-, Tropyl 3,5-dichlorobenzoate, mdl72222