Products 408328-15-4

CAS 408328-15-4 appears in our catalog under these names: Noradrenaline (Norepinephrine) Impurity 20, Norepinephrine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2,5-dihydroxyphenyl)-2-hydroxyethanone (CAS 408328-15-4) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 1-(2,5-dihydroxyphenyl)-2-hydroxyethanone. InChIKey: WTAZWWHANJYPJG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O4
Molecular weight168.15 g/mol
IUPAC name1-(2,5-dihydroxyphenyl)-2-hydroxyethanone
InChIKeyWTAZWWHANJYPJG-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1O)C(=O)CO)O

Computed by PubChem (NCBI)