Products 40846-25-1
CAS 40846-25-1 appears in our catalog under these names: 2-(4-Chlorophenyl)-6,8-dimethylquinoline-4-carbonyl chloride, 95%, 2-(4-Chlorophenyl)-6,8-dimethylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbonyl chloride (CAS 40846-25-1) is a chemical compound with the molecular formula C18H13Cl2NO and a molecular weight of 330.2 g/mol. IUPAC name: 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbonyl chloride. InChIKey: VESUEIUDBAQIKI-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2NO |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbonyl chloride |
| InChIKey | VESUEIUDBAQIKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)Cl)C(=O)Cl)C |
Computed by PubChem (NCBI)