CAS 4085-30-7 appears in our catalog under these names: rac-(1R,2R)-2-(Thiophen-2-yl)cyclopropane-1-carboxylic acid, rac-(1R,2R)-2-(thiophen-2-yl)cyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg.
Trans-(1R,2R)-2-thiophen-2-ylcyclopropane-1-carboxylic acid (CAS 4085-30-7) is a chemical compound with the molecular formula C8H8O2S and a molecular weight of 168.21 g/mol. IUPAC name: trans-(1R,2R)-2-thiophen-2-ylcyclopropane-1-carboxylic acid. InChIKey: OOQRPGJTEUOBHT-PHDIDXHHSA-N.
| Molecular formula | C8H8O2S |
|---|---|
| Molecular weight | 168.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-thiophen-2-ylcyclopropane-1-carboxylic acid |
| InChIKey | OOQRPGJTEUOBHT-PHDIDXHHSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=CS2 |
Computed by PubChem (NCBI)