Products 4086-73-1
CAS 4086-73-1 appears in our catalog under these names: 1–Octylpyridin–1–ium chloride, 1-Octylpyridin-1-ium chloride 97%, 1-Octylpyridin-1-ium chloride, 97%, 1-Octylpyridinium chloride, 97%, 97%, N-Octylpyridinium chloride, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g, 250mg.
1-octylpyridin-1-ium chloride (CAS 4086-73-1) is a chemical compound with the molecular formula C13H22ClN and a molecular weight of 227.77 g/mol. IUPAC name: 1-octylpyridin-1-ium chloride. InChIKey: OVIYAWWBKPWUOH-UHFFFAOYSA-M.
| Molecular formula | C13H22ClN |
|---|---|
| Molecular weight | 227.77 g/mol |
| IUPAC name | 1-octylpyridin-1-ium chloride |
| InChIKey | OVIYAWWBKPWUOH-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+]1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)