Products 40871-47-4

CAS 40871-47-4 is the registry number for 2-Deoxy-2-fluoro-D-glucose 6-phosphate barium salt. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg.

Structural formula: {0} (CAS {1})

[(2R,3R,4S,5R)-5-fluoro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate (CAS 40871-47-4) is a chemical compound with the molecular formula C6H12FO8P and a molecular weight of 262.13 g/mol. IUPAC name: [(2R,3R,4S,5R)-5-fluoro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate. InChIKey: CMLYNMGULQGGIA-SLPGGIOYSA-N.

Identity
Molecular formulaC6H12FO8P
Molecular weight262.13 g/mol
IUPAC name[(2R,3R,4S,5R)-5-fluoro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate
InChIKeyCMLYNMGULQGGIA-SLPGGIOYSA-N
SMILESC([C@H]([C@H]([C@@H]([C@H](C=O)F)O)O)O)OP(=O)(O)O

Computed by PubChem (NCBI)