CAS 40891-99-4 appears in our catalog under these names: Perfluorodiglyme, 95%, Perfluorodiglyme. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 1g, 5g.
1,1,2,2-tetrafluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-2-(trifluoromethoxy)ethane (CAS 40891-99-4) is a chemical compound with the molecular formula C6F14O3 and a molecular weight of 386.04 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-2-(trifluoromethoxy)ethane. InChIKey: YSGKVOMJRCQYMT-UHFFFAOYSA-N.
| Molecular formula | C6F14O3 |
|---|---|
| Molecular weight | 386.04 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-2-(trifluoromethoxy)ethane |
| InChIKey | YSGKVOMJRCQYMT-UHFFFAOYSA-N |
| SMILES | C(C(OC(F)(F)F)(F)F)(OC(C(OC(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)