CAS 4091-99-0 appears in our catalog under these names: 2-(3,6-Diacetoxy-2,7-dichloro-9h-xanthen-9-yl)benzoic acid, 95%, 2',7'-Dichlorodihydrofluorescein Diacetate, >95% (HPLC), H2DCFDA/ 98.06% (existing batch purity), H2DCFDA (DCFH–DA), 2',7'-Dichlorodihydrofluorescein diacetate. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 10mM (in 1ml dmso), 500mg, 1g, 1000mg, 2000mg.
2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid (CAS 4091-99-0) is a chemical compound with the molecular formula C24H16Cl2O7 and a molecular weight of 487.3 g/mol. IUPAC name: 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid. InChIKey: PXEZTIWVRVSYOK-UHFFFAOYSA-N.
| Molecular formula | C24H16Cl2O7 |
|---|---|
| Molecular weight | 487.3 g/mol |
| IUPAC name | 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid |
| InChIKey | PXEZTIWVRVSYOK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl |
Computed by PubChem (NCBI)