CAS 40911-12-4 is the registry number for nitroarginine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid;hydrochloride (CAS 40911-12-4) is a chemical compound with the molecular formula C6H14ClN5O4 and a molecular weight of 255.66 g/mol. IUPAC name: (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid;hydrochloride. InChIKey: ZUVUMQMOOHMBTM-WCCKRBBISA-N.
| Molecular formula | C6H14ClN5O4 |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid;hydrochloride |
| InChIKey | ZUVUMQMOOHMBTM-WCCKRBBISA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)