CAS 40932-60-3 appears in our catalog under these names: 3,5,6-Trichlorosalicylic acid, 98%, 3,5,6-Trichlorosalicylic Acid, >95% (HPLC), 3,5,6–Trichlorosalicylic Acid, 3,5,6-Trichlorosalicylic acid, 3,5,6-Trichlorosalicylic Acid, >97.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 10g, 1g, 250g.
2,3,5-trichloro-6-hydroxybenzoic acid (CAS 40932-60-3) is a chemical compound with the molecular formula C7H3Cl3O3 and a molecular weight of 241.5 g/mol. IUPAC name: 2,3,5-trichloro-6-hydroxybenzoic acid. InChIKey: IIHCUZVBIMTHEB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O3 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 2,3,5-trichloro-6-hydroxybenzoic acid |
| InChIKey | IIHCUZVBIMTHEB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)C(=O)O)O)Cl |
Computed by PubChem (NCBI)