CAS 4095-82-3 appears in our catalog under these names: Sodium 5–amino–9,10–dioxo–9,10–dihydroanthracene–1–sulfonate, Sodium 5-amino-9,10-dioxo-9,10-dihydroanthracene-1-sulfonate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 200mg.
Sodium 5-amino-9,10-dioxoanthracene-1-sulfonate (CAS 4095-82-3) is a chemical compound with the molecular formula C14H8NNaO5S and a molecular weight of 325.27 g/mol. IUPAC name: sodium 5-amino-9,10-dioxoanthracene-1-sulfonate. InChIKey: KHYSIFCUAIDBRJ-UHFFFAOYSA-M.
| Molecular formula | C14H8NNaO5S |
|---|---|
| Molecular weight | 325.27 g/mol |
| IUPAC name | sodium 5-amino-9,10-dioxoanthracene-1-sulfonate |
| InChIKey | KHYSIFCUAIDBRJ-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)C3=C(C2=O)C(=CC=C3)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)