CAS 40954-46-9 is the registry number for cis-Bicyclo-non-2-en-4-one. Offered by: TRC. Available pack sizes: 100mg.
(1S,7S)-bicyclo[5.2.0]non-2-en-4-one (CAS 40954-46-9) is a chemical compound with the molecular formula C9H12O and a molecular weight of 136.19 g/mol. IUPAC name: (1S,7S)-bicyclo[5.2.0]non-2-en-4-one. InChIKey: HLBFWPMIPLQDFY-SFYZADRCSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (1S,7S)-bicyclo[5.2.0]non-2-en-4-one |
| InChIKey | HLBFWPMIPLQDFY-SFYZADRCSA-N |
| SMILES | C1C[C@H]2[C@@H]1CCC(=O)C=C2 |
Computed by PubChem (NCBI)