CAS 41014-96-4 is the registry number for Ferrous D-Tartrate. Offered by: TRC. Available pack sizes: 250mg.
(2R,3R)-2,3-dihydroxybutanedioate;iron(2+) (CAS 41014-96-4) is a chemical compound with the molecular formula C4H4FeO6 and a molecular weight of 203.92 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioate;iron(2+). InChIKey: OHZCFWMJMWFNFP-ZVGUSBNCSA-L.
| Molecular formula | C4H4FeO6 |
|---|---|
| Molecular weight | 203.92 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioate;iron(2+) |
| InChIKey | OHZCFWMJMWFNFP-ZVGUSBNCSA-L |
| SMILES | [C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O.[Fe+2] |
Computed by PubChem (NCBI)