CAS 41036-33-3 appears in our catalog under these names: H-Ala-ala-nh2 hydrochloride, 96%, H-Ala-Ala-NH.2HCl, 97%, H–Ala–Ala–NH₂ · HCl, H-Ala-Ala-NH2·HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 1000mg.
(2S)-2-amino-N-[(2S)-1-amino-1-oxopropan-2-yl]propanamide;hydrochloride (CAS 41036-33-3) is a chemical compound with the molecular formula C6H14ClN3O2 and a molecular weight of 195.65 g/mol. IUPAC name: (2S)-2-amino-N-[(2S)-1-amino-1-oxopropan-2-yl]propanamide;hydrochloride. InChIKey: MVMVOSUNIUACBR-MMALYQPHSA-N.
| Molecular formula | C6H14ClN3O2 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2S)-1-amino-1-oxopropan-2-yl]propanamide;hydrochloride |
| InChIKey | MVMVOSUNIUACBR-MMALYQPHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)N)N.Cl |
Computed by PubChem (NCBI)