CAS 41039-59-2 is the registry number for N-(2-Chlorobenzyl)pyridin-3-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2-chlorophenyl)methyl]pyridin-3-amine;dihydrochloride (CAS 41039-59-2) is a chemical compound with the molecular formula C12H13Cl3N2 and a molecular weight of 291.6 g/mol. IUPAC name: N-[(2-chlorophenyl)methyl]pyridin-3-amine;dihydrochloride. InChIKey: CMOSJRJQNSMBCU-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl3N2 |
|---|---|
| Molecular weight | 291.6 g/mol |
| IUPAC name | N-[(2-chlorophenyl)methyl]pyridin-3-amine;dihydrochloride |
| InChIKey | CMOSJRJQNSMBCU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=CN=CC=C2)Cl.Cl.Cl |
Computed by PubChem (NCBI)