CAS 4104-14-7 is the registry number for Phosacetim, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
N'-bis(4-chlorophenoxy)phosphinothioylethanimidamide (CAS 4104-14-7) is a chemical compound with the molecular formula C14H13Cl2N2O2PS and a molecular weight of 375.2 g/mol. IUPAC name: N'-bis(4-chlorophenoxy)phosphinothioylethanimidamide. InChIKey: XIBXUAZIZXDFTG-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2N2O2PS |
|---|---|
| Molecular weight | 375.2 g/mol |
| IUPAC name | N'-bis(4-chlorophenoxy)phosphinothioylethanimidamide |
| InChIKey | XIBXUAZIZXDFTG-UHFFFAOYSA-N |
| SMILES | CC(=NP(=S)(OC1=CC=C(C=C1)Cl)OC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)