CAS 41057-04-9 appears in our catalog under these names: 2-Nitrothiophene-3-carbaldehyde, 2–Nitrothiophene–3–carbaldehyde. Offered by: TRC, GLPBio. Available pack sizes: 500mg, 100mg, 1g, 250mg.
2-nitrothiophene-3-carbaldehyde (CAS 41057-04-9) is a chemical compound with the molecular formula C5H3NO3S and a molecular weight of 157.15 g/mol. IUPAC name: 2-nitrothiophene-3-carbaldehyde. InChIKey: HPEZITSKOFYWSJ-UHFFFAOYSA-N.
| Molecular formula | C5H3NO3S |
|---|---|
| Molecular weight | 157.15 g/mol |
| IUPAC name | 2-nitrothiophene-3-carbaldehyde |
| InChIKey | HPEZITSKOFYWSJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)