CAS 4106-76-7 appears in our catalog under these names: Pigment yellow 6, 95%, Pigment Yellow 6. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 500mg.
2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS 4106-76-7) is a chemical compound with the molecular formula C16H13ClN4O4 and a molecular weight of 360.75 g/mol. IUPAC name: 2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide. InChIKey: KBNQUAQMTGZQGJ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN4O4 |
|---|---|
| Molecular weight | 360.75 g/mol |
| IUPAC name | 2-[(4-chloro-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide |
| InChIKey | KBNQUAQMTGZQGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(=O)NC1=CC=CC=C1)N=NC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)