Products 41081-90-7

CAS 41081-90-7 is the registry number for 7-METHYL-[1,2,4]TRIAZOLO[4,3-A]PYRIMIDIN-5(1H)-ONE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

7-methyl-1H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one (CAS 41081-90-7) is a chemical compound with the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. IUPAC name: 7-methyl-1H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one. InChIKey: NWZKLXIFHRNXKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N4O
Molecular weight150.14 g/mol
IUPAC name7-methyl-1H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one
InChIKeyNWZKLXIFHRNXKJ-UHFFFAOYSA-N
SMILESCC1=CC(=O)N2C=NNC2=N1

Computed by PubChem (NCBI)