CAS 41102-27-6 appears in our catalog under these names: 2,4,7-Trichlorothieno[3,2-d]pyrimidine 95%, 2,4,7-Trichlorothieno[3,2-d]pyrimidine, 95%, 95%, 2,4,7-Trichlorothieno[3,2-d]pyrimidine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,4,7-trichlorothieno[3,2-d]pyrimidine (CAS 41102-27-6) is a chemical compound with the molecular formula C6HCl3N2S and a molecular weight of 239.5 g/mol. IUPAC name: 2,4,7-trichlorothieno[3,2-d]pyrimidine. InChIKey: HXFWUQXYTRAIOB-UHFFFAOYSA-N.
| Molecular formula | C6HCl3N2S |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2,4,7-trichlorothieno[3,2-d]pyrimidine |
| InChIKey | HXFWUQXYTRAIOB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)