CAS 411208-45-2 is the registry number for MADAM. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-5-methylaniline;dihydrochloride (CAS 411208-45-2) is a chemical compound with the molecular formula C16H22Cl2N2S and a molecular weight of 345.3 g/mol. IUPAC name: 2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-5-methylaniline;dihydrochloride. InChIKey: GSBZMNLLLNHKDY-UHFFFAOYSA-N.
| Molecular formula | C16H22Cl2N2S |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 2-[2-[(dimethylamino)methyl]phenyl]sulfanyl-5-methylaniline;dihydrochloride |
| InChIKey | GSBZMNLLLNHKDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=CC=C2CN(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)