CAS 41122-81-0 is the registry number for 5-Methyl-2-sulfanyl-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methyl-2-sulfanylidene-1,4-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 41122-81-0) is a chemical compound with the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. IUPAC name: 5-methyl-2-sulfanylidene-1,4-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: RAVIAPJFRJKKSL-UHFFFAOYSA-N.
| Molecular formula | C6H6N4OS |
|---|---|
| Molecular weight | 182.21 g/mol |
| IUPAC name | 5-methyl-2-sulfanylidene-1,4-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | RAVIAPJFRJKKSL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=NC(=S)N2)N1 |
Computed by PubChem (NCBI)