CAS 41123-44-8 appears in our catalog under these names: 1H,1H,11H-Eicosafluoroundecyl methacrylate, 92%, 92%, 1H,1H,11H-Eicosafluoroundecyl methacrylate, 92%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 10g.
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-icosafluoroundecyl 2-methylprop-2-enoate (CAS 41123-44-8) is a chemical compound with the molecular formula C15H8F20O2 and a molecular weight of 600.19 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-icosafluoroundecyl 2-methylprop-2-enoate. InChIKey: KDUYSMPJTYKVBA-UHFFFAOYSA-N.
| Molecular formula | C15H8F20O2 |
|---|---|
| Molecular weight | 600.19 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-icosafluoroundecyl 2-methylprop-2-enoate |
| InChIKey | KDUYSMPJTYKVBA-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC(C(C(C(C(C(C(C(C(C(CF)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)