CAS 41149-01-3 appears in our catalog under these names: Ac-Asp-pNA, (S)-3-Acetamido-4-((4-nitrophenyl)amino)-4-oxobutanoic acid, 97%, Ac–Asp–pNA, (S)-3-Acetamido-4-((4-nitrophenyl)amino)-4-oxobutanoic acid, ≥95%, ≥95%. Offered by: Creative Peptides, AmBeed, GLPBio, Chemat. Available pack sizes: 50mg, 250mg, 1g, 10mg, 100mg.
(3S)-3-acetamido-4-(4-nitroanilino)-4-oxobutanoic acid (CAS 41149-01-3) is a chemical compound with the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. IUPAC name: (3S)-3-acetamido-4-(4-nitroanilino)-4-oxobutanoic acid. InChIKey: CZAFZGHQNCYTDG-JTQLQIEISA-N.
| Molecular formula | C12H13N3O6 |
|---|---|
| Molecular weight | 295.25 g/mol |
| IUPAC name | (3S)-3-acetamido-4-(4-nitroanilino)-4-oxobutanoic acid |
| InChIKey | CZAFZGHQNCYTDG-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)